CAS 74495-44-6 is the registry number for 5-Phenyl-6H-1,3,4-thiadiazin-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5-phenyl-6H-1,3,4-thiadiazin-2-amine;hydrochloride (CAS 74495-44-6) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: 5-phenyl-6H-1,3,4-thiadiazin-2-amine;hydrochloride. InChIKey: FWCMBEVJMSPOID-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3S |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 5-phenyl-6H-1,3,4-thiadiazin-2-amine;hydrochloride |
| InChIKey | FWCMBEVJMSPOID-UHFFFAOYSA-N |
| SMILES | C1C(=NN=C(S1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)