Products 609805-55-2

CAS 609805-55-2 appears in our catalog under these names: 2-(1-Isopropylpiperidin-4-yl)acetic acid hydrochloride, (1-Isopropylpiperidin-4-yl)acetic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(1-propan-2-ylpiperidin-4-yl)acetic acid;hydrochloride (CAS 609805-55-2) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2-(1-propan-2-ylpiperidin-4-yl)acetic acid;hydrochloride. InChIKey: LEIVXZXIMGRZMY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name2-(1-propan-2-ylpiperidin-4-yl)acetic acid;hydrochloride
InChIKeyLEIVXZXIMGRZMY-UHFFFAOYSA-N
SMILESCC(C)N1CCC(CC1)CC(=O)O.Cl

Computed by PubChem (NCBI)