Products 61-88-1

CAS 61-88-1 is the registry number for ethyl 2-(2-aminophenyl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-aminophenyl)acetate;hydrochloride (CAS 61-88-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: ethyl 2-(2-aminophenyl)acetate;hydrochloride. InChIKey: QITKMRXHUSYVSD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO2
Molecular weight215.67 g/mol
IUPAC nameethyl 2-(2-aminophenyl)acetate;hydrochloride
InChIKeyQITKMRXHUSYVSD-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CC=CC=C1N.Cl

Computed by PubChem (NCBI)