Products 612-41-9
CAS 612-41-9 appears in our catalog under these names: trans–2–Nitrocinnamic acid, 2-Nitrocinnamic acid, 2-Nitrocinnamic acid, 98%, 98%, 3-(2-Nitrophenyl)acrylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 0,1kg, 0,25kg, 0,5kg, 1g, 5g, 10g.
(E)-3-(2-nitrophenyl)prop-2-enoic acid (CAS 612-41-9) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: (E)-3-(2-nitrophenyl)prop-2-enoic acid. InChIKey: BBQDLDVSEDAYAA-AATRIKPKSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | (E)-3-(2-nitrophenyl)prop-2-enoic acid |
| InChIKey | BBQDLDVSEDAYAA-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Nitrocinnamic acid, o-Nitrocinnamic acid, Cinnamic acid, o-nitro-, 2-Propenoic acid, 3-(2-nitrophenyl)-, (2E)-, 3-(2-Nitrophenyl)propenoic acid, 2-Propenoic acid, 3-(2-nitrophenyl)-, 3-(2-Nitrophenyl)-2-propenoic acid, Cinnamic acid, o-nitro-(6CI,7CI,8CI), (E)-3-(2-Nitrophenyl)acrylic acid, trans-2-Nitrocinnamic acid