Products 612-87-3
CAS 612-87-3 appears in our catalog under these names: Biphenyl-3,3'-dicarboxylic acid, >95% (HPLC), (1,1'–Biphenyl)–3,3'–dicarboxylic acid, [1,1'-Biphenyl]-3,3'-dicarboxylic Acid, >98.0%(GC)(T), Biphenyl-3,3'-dicarboxylic acid 98%, Biphenyl-3,3'-dicarboxylic acid, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg, 25g, 10g, 15g.
3-(3-carboxyphenyl)benzoic acid (CAS 612-87-3) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 3-(3-carboxyphenyl)benzoic acid. InChIKey: KHZYMPDILLAIQY-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3-(3-carboxyphenyl)benzoic acid |
| InChIKey | KHZYMPDILLAIQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
m,m'-Dicarboxybiphenyl, [1,1'-Biphenyl]-3,3'-dicarboxylic acid, 3,3'-Bibenzoic acid, 3,3'-Biphenyldicarboxylic acid, (1,1'-Biphenyl)-3,3'-dicarboxylic acid, 3-(3-carboxyphenyl)benzoic acid, Eltrombopag Impurity 42, Biphenyl-3,3'-dicarboxylicacid, 3,3'-Diphenic acid, [1,1'-Biphenyl]-3,3'-dicarboxylicacid