CAS 61280-75-9 appears in our catalog under these names: N-Boc-p-nitro-D-phenylalanine, Boc-D-Phe(4-NO2)-OH, 97%, Boc–D–Phe(4–NO2)–OH, Boc-D-Phe(4-NO2)-OH, N-(tert-Butoxycarbonyl)-4-nitro-D-phenylalanine, >98.0%(HPLC). Offered by: TRC, AmBeed, GLPBio, Iris Biotech, TCI. Available pack sizes: 5g, 1g, 25g, 10g, 100g, 500g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid (CAS 61280-75-9) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid. InChIKey: XBQADBXCNQPHHY-LLVKDONJSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid |
| InChIKey | XBQADBXCNQPHHY-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)