Products 613-17-2
CAS 613-17-2 appears in our catalog under these names: 7–Hydroxy–2–naphthoic acid, 7-hydroxy-2-naphthoic acid, 7-Hydroxy-2-naphthoic acid 95%, 7-Hydroxy-2-naphthoic acid, 96%, 7-Hydroxy-2-naphthoic acid, 96%, 96%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 0,5g, 100mg, 1g.
7-hydroxynaphthalene-2-carboxylic acid (CAS 613-17-2) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 7-hydroxynaphthalene-2-carboxylic acid. InChIKey: FSXKKRVQMPPAMQ-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 7-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | FSXKKRVQMPPAMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)O)C(=O)O |
Computed by PubChem (NCBI)