CAS 61416-81-7 appears in our catalog under these names: 3,5-Dimethoxybenzimidamide hydrochloride, 95%, 95%, 3,5-Dimethoxy-benzamidine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3,5-dimethoxybenzenecarboximidamide;hydrochloride (CAS 61416-81-7) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 3,5-dimethoxybenzenecarboximidamide;hydrochloride. InChIKey: JYCNBCYWSLQCFS-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 3,5-dimethoxybenzenecarboximidamide;hydrochloride |
| InChIKey | JYCNBCYWSLQCFS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=N)N)OC.Cl |
Computed by PubChem (NCBI)