Products 61471-43-0
CAS 61471-43-0 appears in our catalog under these names: 4-((Methoxyimino)methyl)benzoic acid, 4-[(Methoxyimino)Methyl]Benzoic Acid, ≥95%, ≥95%, 4-[(METHOXYIMINO)METHYL]BENZOIC ACID, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 25mg.
4-[(E)-methoxyiminomethyl]benzoic acid (CAS 61471-43-0) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4-[(E)-methoxyiminomethyl]benzoic acid. InChIKey: GOJYSIUTEMBHIG-UXBLZVDNSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 4-[(E)-methoxyiminomethyl]benzoic acid |
| InChIKey | GOJYSIUTEMBHIG-UXBLZVDNSA-N |
| SMILES | CO/N=C/C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)