CAS 61613-22-7 appears in our catalog under these names: 2-Bromodiphenylamine, >98.0%(GC), 2-Bromo-N-phenylaniline, 2-Bromo-N-phenylaniline 98%, Benzenamine, 2-bromo-N-phenyl-, 99%, 99%, 2-Bromo-N-phenylaniline, 97%. Offered by: TCI, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 0,25g, 250mg, 25g, 100g, 10g.
2-bromo-N-phenylaniline (CAS 61613-22-7) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 2-bromo-N-phenylaniline. InChIKey: WAAWAHYRHUWAFM-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 2-bromo-N-phenylaniline |
| InChIKey | WAAWAHYRHUWAFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2Br |
Computed by PubChem (NCBI)