CAS 618383-51-0 appears in our catalog under these names: 5-(4-Fluorophenyl)isoxazole-4-carboxylic acid, 95%, 95%, 5-(4-Fluorophenyl)isoxazole-4-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g.
5-(4-fluorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 618383-51-0) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: FFZWHPBPXYQOSJ-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | FFZWHPBPXYQOSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NO2)C(=O)O)F |
Computed by PubChem (NCBI)