Products 882-06-4
CAS 882-06-4 is the registry number for trans-4-Nitrocinnamic acid, 98+% . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g.
(E)-3-(4-nitrophenyl)prop-2-enoic acid (CAS 882-06-4) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: (E)-3-(4-nitrophenyl)prop-2-enoic acid. InChIKey: XMMRNCHTDONGRJ-ZZXKWVIFSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | (E)-3-(4-nitrophenyl)prop-2-enoic acid |
| InChIKey | XMMRNCHTDONGRJ-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
trans-4-Nitrocinnamic acid, (E)-p-Nitrocinnamic acid, 4-Nitrocinnamic acid, 3-(4-Nitrophenyl)acrylic acid, p-Nitrocinnamic acid, (E)-3-(4-Nitrophenyl)acrylic acid, Cinnamic acid, p-nitro-, (E)-3-(4-nitrophenyl)prop-2-enoic acid, (2E)-3-(4-nitrophenyl)prop-2-enoic acid, 3-(4-Nitrophenyl)propenoic acid