CAS 62484-76-8 appears in our catalog under these names: 5,7-Dimethyl-3-formylchromone, 97%, 5,7-Dimethyl-4-oxo-4H-chromene-3-carbaldehyde, 97%, 5,7–Dimethyl–4–oxo–4H–chromene–3–carbaldehyde. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 250mg.
5,7-dimethyl-4-oxochromene-3-carbaldehyde (CAS 62484-76-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 5,7-dimethyl-4-oxochromene-3-carbaldehyde. InChIKey: MVKCOCQJKGTQAM-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5,7-dimethyl-4-oxochromene-3-carbaldehyde |
| InChIKey | MVKCOCQJKGTQAM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)OC=C(C2=O)C=O)C |
Computed by PubChem (NCBI)