CAS 62507-85-1 appears in our catalog under these names: 4-(3-Methylphenoxy)benzoic acid, 95%, 4-(m-Tolyloxy)benzoic acid, 95+%, 4-(3-Methylphenoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
4-(3-methylphenoxy)benzoic acid (CAS 62507-85-1) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 4-(3-methylphenoxy)benzoic acid. InChIKey: XBZMSARMROSBTE-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-(3-methylphenoxy)benzoic acid |
| InChIKey | XBZMSARMROSBTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)