CAS 625112-44-9 appears in our catalog under these names: 2,4–Dimethyl–5–nitrobenzonitrile, 2,4-Dimethyl-5-nitrobenzonitrile 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g.
2,4-dimethyl-5-nitrobenzonitrile (CAS 625112-44-9) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2,4-dimethyl-5-nitrobenzonitrile. InChIKey: XFCHWOZARCTQMI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2,4-dimethyl-5-nitrobenzonitrile |
| InChIKey | XFCHWOZARCTQMI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C#N)[N+](=O)[O-])C |
Computed by PubChem (NCBI)