CAS 6269-44-9 is the registry number for 3-(1,3-Benzothiazol-2-yl)butan-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(1,3-benzothiazol-2-yl)butan-2-one (CAS 6269-44-9) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)butan-2-one. InChIKey: ZZDKCNNIPGACNK-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-yl)butan-2-one |
| InChIKey | ZZDKCNNIPGACNK-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=CC=CC=C2S1)C(=O)C |
Computed by PubChem (NCBI)