CAS 62773-65-3 appears in our catalog under these names: Mesalazine Ethyl Ester, Ethyl 5-amino-2-hydroxybenzoate. Offered by: Mikromol, Biosynth. Available pack sizes: 25mg, 100mg, 0,5g, 50mg.
Ethyl 5-amino-2-hydroxybenzoate (CAS 62773-65-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 5-amino-2-hydroxybenzoate. InChIKey: FYCPYYOESKUODV-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | ethyl 5-amino-2-hydroxybenzoate |
| InChIKey | FYCPYYOESKUODV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)N)O |
Computed by PubChem (NCBI)