Products 6291-02-7
CAS 6291-02-7 is the registry number for 4-Chloro-3-methyl-benzenesulfonyl chloride, 95%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-chloro-3-methylbenzenesulfonyl chloride (CAS 6291-02-7) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 4-chloro-3-methylbenzenesulfonyl chloride. InChIKey: WEPYREBDJIVOHD-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 4-chloro-3-methylbenzenesulfonyl chloride |
| InChIKey | WEPYREBDJIVOHD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-3-methylbenzene-1-sulfonyl chloride, 4-chloro-3-methylbenzenesulfonyl chloride, 4-chloro-3-methyl-benzenesulfonyl chloride, 3-methyl-4-chlorobenzenesulfonyl chloride, 4-Chloro-3-methylbenzene-1-sulfonylchloride, WEPYREBDJIVOHD-UHFFFAOYSA-N, chloro(4-chloro-3-methylphenyl)sulfone, 4-chloro-3-methylbenzenesulfonyl chloride, AldrichCPR