CAS 63060-94-6 appears in our catalog under these names: (R)–Ethyl 2–amino–3–phenylpropanoate hydrochloride, D-PHENYLALANINE ETHYL ESTER HYDROCHLORIDE, 97%, 97%, (R)-Ethyl 2-amino-3-phenylpropionate hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 5g, 25g.
Ethyl (2R)-2-amino-3-phenylpropanoate;hydrochloride (CAS 63060-94-6) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: ethyl (2R)-2-amino-3-phenylpropanoate;hydrochloride. InChIKey: FPFQPLFYTKMCHN-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | FPFQPLFYTKMCHN-HNCPQSOCSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)