CAS 6312-85-2 is the registry number for 2-(3-Chlorophenoxy)-benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3-chlorophenoxy)benzoic acid (CAS 6312-85-2) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: 2-(3-chlorophenoxy)benzoic acid. InChIKey: NQOFGDFOEKXOBQ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO3 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 2-(3-chlorophenoxy)benzoic acid |
| InChIKey | NQOFGDFOEKXOBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)