Products 63147-73-9

CAS 63147-73-9 is the registry number for 2-HYDROXYETHYL 3-AMINOBENZOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-hydroxyethyl 3-aminobenzoate (CAS 63147-73-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-hydroxyethyl 3-aminobenzoate. InChIKey: HHTUVAFHMOYGRT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO3
Molecular weight181.19 g/mol
IUPAC name2-hydroxyethyl 3-aminobenzoate
InChIKeyHHTUVAFHMOYGRT-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)N)C(=O)OCCO

Computed by PubChem (NCBI)