CAS 63147-73-9 is the registry number for 2-HYDROXYETHYL 3-AMINOBENZOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-hydroxyethyl 3-aminobenzoate (CAS 63147-73-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-hydroxyethyl 3-aminobenzoate. InChIKey: HHTUVAFHMOYGRT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-hydroxyethyl 3-aminobenzoate |
| InChIKey | HHTUVAFHMOYGRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)OCCO |
Computed by PubChem (NCBI)