CAS 63220-36-0 is the registry number for Benzyl (Isothiocyanato)formate. Offered by: TRC. Available pack sizes: 2,5g.
Benzyl N-(sulfanylidenemethylidene)carbamate (CAS 63220-36-0) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: benzyl N-(sulfanylidenemethylidene)carbamate. InChIKey: XBNBAQHNOPTJOR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | benzyl N-(sulfanylidenemethylidene)carbamate |
| InChIKey | XBNBAQHNOPTJOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N=C=S |
Computed by PubChem (NCBI)