CAS 6333-39-7 is the registry number for 2-(2,4-Dichlorophenoxy)-N,N-dimethylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenoxy)-N,N-dimethylacetamide (CAS 6333-39-7) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N,N-dimethylacetamide. InChIKey: OCZUDNHTFSZUDM-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N,N-dimethylacetamide |
| InChIKey | OCZUDNHTFSZUDM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)