CAS 63480-11-5 appears in our catalog under these names: 4-Methyl-isatoic anhydride, 97%, 7–Methyl–1H–benzo(d)(1,3)oxazine–2,4–dione, 7-Methyl-1H-benzo[d][1,3]oxazine-2,4-dione 97%, 7-Methyl-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98%, 4-METHYL-ISATOIC ANHYDRIDE, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100mg.
7-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 63480-11-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 7-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: FTOHSJGKIFDLQU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 7-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | FTOHSJGKIFDLQU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)