Products 634907-30-5
CAS 634907-30-5 appears in our catalog under these names: Censavudine, Festinavir, Censavudine, 99+%, 2′,3′-Didehydro-3′-deoxy-4′-ethynylthymidine, Censavudine, 98.71%. Offered by: GLPBio, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 2mg, 25mg, 50mg, 25 mg.
1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 634907-30-5) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: OSYWBJSVKUFFSU-SKDRFNHKSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | OSYWBJSVKUFFSU-SKDRFNHKSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C=C[C@](O2)(CO)C#C |
Computed by PubChem (NCBI)