CAS 63580-19-8 is the registry number for 3-Chloro-5-(2-chlorophenyl)-1H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-chloro-3-(2-chlorophenyl)-1H-1,2,4-triazole (CAS 63580-19-8) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 5-chloro-3-(2-chlorophenyl)-1H-1,2,4-triazole. InChIKey: SQOOCXKEAOZMFU-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 5-chloro-3-(2-chlorophenyl)-1H-1,2,4-triazole |
| InChIKey | SQOOCXKEAOZMFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=N2)Cl)Cl |
Computed by PubChem (NCBI)