Products 6384-86-7
CAS 6384-86-7 is the registry number for Benzyl 4-(aminomethyl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Benzyl 4-(aminomethyl)benzoate;hydrochloride (CAS 6384-86-7) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: benzyl 4-(aminomethyl)benzoate;hydrochloride. InChIKey: UZOWFJATINCKSI-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | benzyl 4-(aminomethyl)benzoate;hydrochloride |
| InChIKey | UZOWFJATINCKSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)