Products 63905-67-9

CAS 63905-67-9 is the registry number for 5,6-Dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,6-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride (CAS 63905-67-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 5,6-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride. InChIKey: QPBAENLXKAWWOO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO2
Molecular weight229.70 g/mol
IUPAC name5,6-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride
InChIKeyQPBAENLXKAWWOO-UHFFFAOYSA-N
SMILESCOC1=C(C2=C(C[NH2+]CC2)C=C1)OC.[Cl-]

Computed by PubChem (NCBI)