CAS 63905-67-9 is the registry number for 5,6-Dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride (CAS 63905-67-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 5,6-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride. InChIKey: QPBAENLXKAWWOO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 5,6-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride |
| InChIKey | QPBAENLXKAWWOO-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C[NH2+]CC2)C=C1)OC.[Cl-] |
Computed by PubChem (NCBI)