CAS 64179-42-6 is the registry number for Noscapine Impurity 8. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-(hydroxymethyl)-2,3-dimethoxybenzoic acid (CAS 64179-42-6) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 6-(hydroxymethyl)-2,3-dimethoxybenzoic acid. InChIKey: CRYRRQNXPBRNOP-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 6-(hydroxymethyl)-2,3-dimethoxybenzoic acid |
| InChIKey | CRYRRQNXPBRNOP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CO)C(=O)O)OC |
Computed by PubChem (NCBI)