Products 64190-94-9
CAS 64190-94-9 appears in our catalog under these names: Zanthobungeanine, Zanthobungeanine, 98%, 98%, Zanthobungeanine, 99.56%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
7-methoxy-2,2,6-trimethylpyrano[3,2-c]quinolin-5-one (CAS 64190-94-9) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: 7-methoxy-2,2,6-trimethylpyrano[3,2-c]quinolin-5-one. InChIKey: SYNIFQKDJZQOLI-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 7-methoxy-2,2,6-trimethylpyrano[3,2-c]quinolin-5-one |
| InChIKey | SYNIFQKDJZQOLI-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C3=C(C(=CC=C3)OC)N(C2=O)C)C |
Computed by PubChem (NCBI)