CAS 64377-71-5 is the registry number for Dabigatran Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-cyanoanilino)acetic acid (CAS 64377-71-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(2-cyanoanilino)acetic acid. InChIKey: KLDARDDDCUWMJE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(2-cyanoanilino)acetic acid |
| InChIKey | KLDARDDDCUWMJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)NCC(=O)O |
Computed by PubChem (NCBI)