CAS 649774-32-3 is the registry number for 3-(3-(4-(1,1-Dimethylethyl)phenoxy)-2-oxo-1-pyrrolidinyl)-benzoic Acid. Offered by: TRC. Available pack sizes: 1g.
3-[3-(4-tert-butylphenoxy)-2-oxopyrrolidin-1-yl]benzoic acid (CAS 649774-32-3) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 3-[3-(4-tert-butylphenoxy)-2-oxopyrrolidin-1-yl]benzoic acid. InChIKey: KXVHJZFBHHNPJJ-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 3-[3-(4-tert-butylphenoxy)-2-oxopyrrolidin-1-yl]benzoic acid |
| InChIKey | KXVHJZFBHHNPJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC2CCN(C2=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)