CAS 64985-42-8 appears in our catalog under these names: 2-(2-(4-Hydroxyphenyl)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione, 2-[2-(4-hydroxyphenyl)ethyl]-2,3-dihydro-1H-isoindole-1,3-dione, 95%, 95%, 2-[2-(4-HYDROXYPHENYL)ETHYL]-2,3-DIHYDRO-1H-ISOINDOLE-1,3-DIONE. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 25g, 50g.
2-[2-(4-hydroxyphenyl)ethyl]isoindole-1,3-dione (CAS 64985-42-8) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 2-[2-(4-hydroxyphenyl)ethyl]isoindole-1,3-dione. InChIKey: VGTDJOXZSROPLT-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-[2-(4-hydroxyphenyl)ethyl]isoindole-1,3-dione |
| InChIKey | VGTDJOXZSROPLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)