Products 652-55-1
CAS 652-55-1 is the registry number for Curvulic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-acetyl-3,5-dihydroxy-4-methoxyphenyl)acetic acid (CAS 652-55-1) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(2-acetyl-3,5-dihydroxy-4-methoxyphenyl)acetic acid. InChIKey: QSWOSJNPHIHNIR-UHFFFAOYSA-N.
| Molecular formula | C11H12O6 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-(2-acetyl-3,5-dihydroxy-4-methoxyphenyl)acetic acid |
| InChIKey | QSWOSJNPHIHNIR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1CC(=O)O)O)OC)O |
Computed by PubChem (NCBI)