CAS 65466-29-7 is the registry number for 3-Nitro(1,5)-benzodiazepine/ 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
3-nitro-3H-1,5-benzodiazepine (CAS 65466-29-7) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 3-nitro-3H-1,5-benzodiazepine. InChIKey: SGIGOTZNQITOJU-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-nitro-3H-1,5-benzodiazepine |
| InChIKey | SGIGOTZNQITOJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)