Products 65515-37-9
CAS 65515-37-9 appears in our catalog under these names: 2-Methoxy-4,6-dimethylpyridine-3-carboxylic acid, 95%, 2-Methoxy-4,6-dimethylnicotinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
2-methoxy-4,6-dimethylpyridine-3-carboxylic acid (CAS 65515-37-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-methoxy-4,6-dimethylpyridine-3-carboxylic acid. InChIKey: OILYJALBGQMVGR-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-methoxy-4,6-dimethylpyridine-3-carboxylic acid |
| InChIKey | OILYJALBGQMVGR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)OC)C |
Computed by PubChem (NCBI)