CAS 65733-15-5 appears in our catalog under these names: H–D–Tyr(Bzl)–OH, H-D-Tyr(Bzl)-OH, 97%, H-D-Tyr(Bzl)-OH, (R)-2-Amino-3-(4-(benzyloxy)phenyl)propanoic acid, 97%. Offered by: GLPBio, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 25g, 1g.
(2R)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 65733-15-5) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: (2R)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: KAFHLONDOVSENM-OAHLLOKOSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | KAFHLONDOVSENM-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)