Products 6574-95-4
CAS 6574-95-4 appears in our catalog under these names: (2–Cyanophenoxy)acetic Acid, 2-(2-Cyanophenoxy)acetic acid, (2-Cyanophenoxy)acetic Acid 97%, (2-Cyanophenoxy)acetic Acid, 98%, 98%, (2-Cyano-phenoxy)-acetic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 0,25g, 10g, 25g, 100mg, 250mg.
2-(2-cyanophenoxy)acetic acid (CAS 6574-95-4) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-(2-cyanophenoxy)acetic acid. InChIKey: FNJPHLBTJIHHPG-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-(2-cyanophenoxy)acetic acid |
| InChIKey | FNJPHLBTJIHHPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OCC(=O)O |
Computed by PubChem (NCBI)