CAS 66176-17-8 appears in our catalog under these names: 3-Methylisatoic anhydride, 8-Methyl-1H-benzo[d][1,3]oxazine-2,4-dione 98%, 8-Methyl-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98%, 3-Methyl-isatoic anhydride, 96%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,25g, 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g.
8-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 66176-17-8) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 8-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: CHKUQVBJPDLANA-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 8-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | CHKUQVBJPDLANA-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)