CAS 6633-40-5 is the registry number for 7-Nitrofluoren-2-ol. Offered by: TRC. Available pack sizes: 500mg, 50mg.
7-nitro-9H-fluoren-2-ol (CAS 6633-40-5) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 7-nitro-9H-fluoren-2-ol. InChIKey: VFTOHJFKIJLYKN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 7-nitro-9H-fluoren-2-ol |
| InChIKey | VFTOHJFKIJLYKN-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])C3=C1C=C(C=C3)O |
Computed by PubChem (NCBI)