Products 66380-03-8

CAS 66380-03-8 is the registry number for 2-(Methylamino)-2-(4-methylphenyl)acetic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

2-(methylamino)-2-(4-methylphenyl)acetic acid;hydrochloride (CAS 66380-03-8) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2-(methylamino)-2-(4-methylphenyl)acetic acid;hydrochloride. InChIKey: VCSCYZLFUOOBAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO2
Molecular weight215.67 g/mol
IUPAC name2-(methylamino)-2-(4-methylphenyl)acetic acid;hydrochloride
InChIKeyVCSCYZLFUOOBAZ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(C(=O)O)NC.Cl

Computed by PubChem (NCBI)