Products 6640-09-1
CAS 6640-09-1 appears in our catalog under these names: 5-(Benzyloxy)-1H-indole-2-carboxylic acid, 97%, 5-(Benzyloxy)-1H-indole-2-carboxylic acid, 98%, 5-Benzyloxy-1H-indole-2-carboxylic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
5-phenylmethoxy-1H-indole-2-carboxylic acid (CAS 6640-09-1) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 5-phenylmethoxy-1H-indole-2-carboxylic acid. InChIKey: MVCLSAMNMAWXFQ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 5-phenylmethoxy-1H-indole-2-carboxylic acid |
| InChIKey | MVCLSAMNMAWXFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC(=C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(Phenylmethoxy)-1H-indole-2-carboxylic acid, 5-(benzyloxy)-1H-indole-2-carboxylic acid, 5-Benzyloxyindole-2-carboxylic acid, 5-Benzyloxy-1H-indole-2-carboxylic acid, 1H-Indole-2-carboxylic acid, 5-(phenylmethoxy)-, 5-phenylmethoxy-1H-indole-2-carboxylic acid, 5-(phenylmethoxy)indole-2-carboxylic acid, Indole-3-14C-2-carboxylic acid, 5-(benzyloxy)-, Maybridge1_005333, Oprea1_472789