CAS 66624-11-1 appears in our catalog under these names: (1,1'-Biphenyl)-2,4,4'-triol, 95%, 2,4,4'-Trihydroxybiphenyl, 4-(4-hydroxyphenyl)benzene-1,3-diol, 98%. Offered by: AmBeed, TRC, Fluorochem. Available pack sizes: 1g, 500mg, 25mg.
4-(4-hydroxyphenyl)benzene-1,3-diol (CAS 66624-11-1) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 4-(4-hydroxyphenyl)benzene-1,3-diol. InChIKey: CDABMPUGYTZWIY-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)benzene-1,3-diol |
| InChIKey | CDABMPUGYTZWIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)