CAS 667887-31-2 is the registry number for 2-(N-(4-Phenoxyphenyl)carbamoyl)cyclohexanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 25mg.
2-[(4-phenoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid (CAS 667887-31-2) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 2-[(4-phenoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid. InChIKey: JNCSQROSIMRUQO-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-[(4-phenoxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| InChIKey | JNCSQROSIMRUQO-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C(=O)NC2=CC=C(C=C2)OC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)