Products 668-24-6
CAS 668-24-6 is the registry number for 4-Fluoro-7-methyl isatin, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-fluoro-7-methyl-1H-indole-2,3-dione (CAS 668-24-6) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-fluoro-7-methyl-1H-indole-2,3-dione. InChIKey: GMOIUCVMHIKMDC-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-fluoro-7-methyl-1H-indole-2,3-dione |
| InChIKey | GMOIUCVMHIKMDC-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
4-fluoro-7-methyl-2,3-dihydro-1H-indole-2,3-dione, 4-fluoro-7-methylisatin, 4-Fluoro-7-methyl isatin, 4-fluoro-7-methylindoline-2,3-dione, 4-fluoro-7-methyl-1h-indole-2,3-dione, 1H-Indole-2,3-dione, 4-fluoro-7-methyl-, GMOIUCVMHIKMDC-UHFFFAOYSA-N, 4-fluoro-7-methyl-1H-benzo[d]azoline-2,3-dione