CAS 670-83-7 appears in our catalog under these names: 2,4–Diphenylimidazole, 2,5-Diphenyl-1H-imidazole 98%, 2,5-Diphenyl-1H-imidazole, 98%, 98%, 2,4-Diphenyl-1H-imidazole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g.
2,5-diphenyl-1H-imidazole (CAS 670-83-7) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 2,5-diphenyl-1H-imidazole. InChIKey: FHHCKYIBYRNHOZ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2,5-diphenyl-1H-imidazole |
| InChIKey | FHHCKYIBYRNHOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)