CAS 672957-92-5 appears in our catalog under these names: 1-Methyl-1h-benzimidazole-4-carboxylic acid, 95%, 1-Methyl-4-benzimidazolecarboxylic Acid, 98+%, 1–Methyl–4–benzimidazolecarboxylic Acid, 1-Methyl-4-benzimidazolecarboxylic acid, 1-Methyl-4-benzimidazolecarboxylic Acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
1-methylbenzimidazole-4-carboxylic acid (CAS 672957-92-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylbenzimidazole-4-carboxylic acid. InChIKey: KANGLPGGTDOWJO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylbenzimidazole-4-carboxylic acid |
| InChIKey | KANGLPGGTDOWJO-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C=CC=C21)C(=O)O |
Computed by PubChem (NCBI)