CAS 672957-99-2 is the registry number for 1-Methyl-1H-1,3-benzodiazole-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methylbenzimidazole-4-carboxylic acid (CAS 672957-99-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-methylbenzimidazole-4-carboxylic acid. InChIKey: KGMXGKIPZPNWST-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-methylbenzimidazole-4-carboxylic acid |
| InChIKey | KGMXGKIPZPNWST-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=CC=CC(=C21)C(=O)O |
Computed by PubChem (NCBI)