CAS 67400-25-3 appears in our catalog under these names: 3-Bromo-5-nitroindazole 97%, 3-Bromo-5-nitroindazole, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 500g.
3-bromo-5-nitro-2H-indazole (CAS 67400-25-3) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 3-bromo-5-nitro-2H-indazole. InChIKey: SYTGRKBQTUKOAI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 3-bromo-5-nitro-2H-indazole |
| InChIKey | SYTGRKBQTUKOAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)