CAS 675602-63-8 appears in our catalog under these names: 2-(3'-Pyridyl)phenylacetic acid, 95%, 2-(2-(Pyridin-3-yl)phenyl)acetic acid, 95%, 2-(3'-Pyridyl)phenylacetic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
2-(2-pyridin-3-ylphenyl)acetic acid (CAS 675602-63-8) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-(2-pyridin-3-ylphenyl)acetic acid. InChIKey: PMPVQDCSSJCWGH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-(2-pyridin-3-ylphenyl)acetic acid |
| InChIKey | PMPVQDCSSJCWGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)